C19H15F3N4O2S — CID 67646264
N-[1-(cyanomethyl)-4-(4-methylphenyl)-5-(trifluoromethyl)pyrazol-3-yl]benzenesulfonamide (PubChem CID 67646264) has the molecular formula C19H15F3N4O2S and a molecular weight of 420.42 g/mol. Its IUPAC name is N-[1-(cyanomethyl)-4-(4-methylphenyl)-5-(trifluoromethyl)pyrazol-3-yl]benzenesulfonamide.
| Compound Name | N-[1-(cyanomethyl)-4-(4-methylphenyl)-5-(trifluoromethyl)pyrazol-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 67646264 |
| Molecular Formula | C19H15F3N4O2S |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | N-[1-(cyanomethyl)-4-(4-methylphenyl)-5-(trifluoromethyl)pyrazol-3-yl]benzenesulfonamide |
| SMILES | Cc1ccc(-c2c(NS(=O)(=O)c3ccccc3)nn(CC#N)c2C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H15F3N4O2S/c1-13-7-9-14(10-8-13)16-17(19(20,21)22)26(12-11-23)24-18(16)25-29(27,28)15-5-3-2-4-6-15/h2-10H,12H2,1H3,(H,24,25) |
| InChIKey | GFXLBWURIFKFHP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |