About 3,5-dicyano-4,4-dipropylcyclohexane-1-carboxamide
3,5-dicyano-4,4-dipropylcyclohexane-1-carboxamide (PubChem CID 67646365) has the molecular formula C15H23N3O
and a molecular weight of 261.37 g/mol. Its IUPAC name is 3,5-dicyano-4,4-dipropylcyclohexane-1-carboxamide.
Molecular Properties
| Compound Name | 3,5-dicyano-4,4-dipropylcyclohexane-1-carboxamide |
| PubChem CID | 67646365 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | 3,5-dicyano-4,4-dipropylcyclohexane-1-carboxamide |
| SMILES | CCCC1(CCC)C(C#N)CC(C(N)=O)CC1C#N |
| InChI | InChI=1S/C15H23N3O/c1-3-5-15(6-4-2)12(9-16)7-11(14(18)19)8-13(15)10-17/h11-13H,3-8H2,1-2H3,(H2,18,19) |
| InChIKey | RYJTUEZSQBBVFJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 90.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-dicyano-4,4-dipropylcyclohexane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dicyano-4,4-dipropylcyclohexane-1-carboxamide?
The IUPAC name of 3,5-dicyano-4,4-dipropylcyclohexane-1-carboxamide (CID 67646365) is 3,5-dicyano-4,4-dipropylcyclohexane-1-carboxamide.
What is the SMILES notation for 3,5-dicyano-4,4-dipropylcyclohexane-1-carboxamide?
The canonical SMILES for 3,5-dicyano-4,4-dipropylcyclohexane-1-carboxamide is CCCC1(CCC)C(C#N)CC(C(N)=O)CC1C#N.
What is the InChIKey of 3,5-dicyano-4,4-dipropylcyclohexane-1-carboxamide?
The InChIKey is RYJTUEZSQBBVFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3O/c1-3-5-15(6-4-2)12(9-16)7-11(14(18)19)8-13(15)10-17/h11-13H,3-8H2,1-2H3,(H2,18,19).
What are the key properties of 3,5-dicyano-4,4-dipropylcyclohexane-1-carboxamide?
3,5-dicyano-4,4-dipropylcyclohexane-1-carboxamide has a molecular weight of 261.37 g/mol, XLogP of 2.75, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dicyano-4,4-dipropylcyclohexane-1-carboxamide is sourced from PubChem (CID 67646365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).