C32H34Cl2N4O3 — CID 67646604
N-[4-[2,7-dichloro-5-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl]phenyl]-2-methylbenzamide (PubChem CID 67646604) has the molecular formula C32H34Cl2N4O3 and a molecular weight of 593.56 g/mol. Its IUPAC name is N-[4-[2,7-dichloro-5-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl]phenyl]-2-methylbenzamide.
| Compound Name | N-[4-[2,7-dichloro-5-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl]phenyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 67646604 |
| Molecular Formula | C32H34Cl2N4O3 |
| Molecular Weight | 593.56 g/mol |
| Exact Mass | 592.20 |
| IUPAC Name | N-[4-[2,7-dichloro-5-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl]phenyl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)Nc1ccc(C(=O)N2c3ccc(Cl)cc3C(CC(=O)N3CCN(C)CC3)CCC2Cl)cc1 |
| InChI | InChI=1S/C32H34Cl2N4O3/c1-21-5-3-4-6-26(21)31(40)35-25-11-7-22(8-12-25)32(41)38-28-13-10-24(33)20-27(28)23(9-14-29(38)34)19-30(39)37-17-15-36(2)16-18-37/h3-8,10-13,20,23,29H,9,14-19H2,1-2H3,(H,35,40) |
| InChIKey | HCLRKLBCCPQFPV-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.56 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|