About ethyl 2-[3-[3-[(E)-2-(6,7-difluoroquinolin-2-yl)ethenyl]phenyl]-3-hydroxypropyl]benzoate
ethyl 2-[3-[3-[(E)-2-(6,7-difluoroquinolin-2-yl)ethenyl]phenyl]-3-hydroxypropyl]benzoate (PubChem CID 67646788) has the molecular formula C29H25F2NO3
and a molecular weight of 473.52 g/mol. Its IUPAC name is ethyl 2-[3-[3-[(E)-2-(6,7-difluoroquinolin-2-yl)ethenyl]phenyl]-3-hydroxypropyl]benzoate.
Molecular Properties
| Compound Name | ethyl 2-[3-[3-[(E)-2-(6,7-difluoroquinolin-2-yl)ethenyl]phenyl]-3-hydroxypropyl]benzoate |
| PubChem CID | 67646788 |
| Molecular Formula | C29H25F2NO3 |
| Molecular Weight | 473.52 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | ethyl 2-[3-[3-[(E)-2-(6,7-difluoroquinolin-2-yl)ethenyl]phenyl]-3-hydroxypropyl]benzoate |
| SMILES | CCOC(=O)c1ccccc1CCC(O)c1cccc(/C=C/c2ccc3cc(F)c(F)cc3n2)c1 |
| InChI | InChI=1S/C29H25F2NO3/c1-2-35-29(34)24-9-4-3-7-20(24)12-15-28(33)22-8-5-6-19(16-22)10-13-23-14-11-21-17-25(30)26(31)18-27(21)32-23/h3-11,13-14,16-18,28,33H,2,12,15H2,1H3/b13-10+ |
| InChIKey | RJMSIWCOYANILO-JLHYYAGUSA-N |
| XLogP | 6.53 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 473.52 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-[3-[3-[(E)-2-(6,7-difluoroquinolin-2-yl)ethenyl]phenyl]-3-hydroxypropyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[3-[3-[(E)-2-(6,7-difluoroquinolin-2-yl)ethenyl]phenyl]-3-hydroxypropyl]benzoate?
The IUPAC name of ethyl 2-[3-[3-[(E)-2-(6,7-difluoroquinolin-2-yl)ethenyl]phenyl]-3-hydroxypropyl]benzoate (CID 67646788) is ethyl 2-[3-[3-[(E)-2-(6,7-difluoroquinolin-2-yl)ethenyl]phenyl]-3-hydroxypropyl]benzoate.
What is the SMILES notation for ethyl 2-[3-[3-[(E)-2-(6,7-difluoroquinolin-2-yl)ethenyl]phenyl]-3-hydroxypropyl]benzoate?
The canonical SMILES for ethyl 2-[3-[3-[(E)-2-(6,7-difluoroquinolin-2-yl)ethenyl]phenyl]-3-hydroxypropyl]benzoate is CCOC(=O)c1ccccc1CCC(O)c1cccc(/C=C/c2ccc3cc(F)c(F)cc3n2)c1.
What is the InChIKey of ethyl 2-[3-[3-[(E)-2-(6,7-difluoroquinolin-2-yl)ethenyl]phenyl]-3-hydroxypropyl]benzoate?
The InChIKey is RJMSIWCOYANILO-JLHYYAGUSA-N. The full InChI is InChI=1S/C29H25F2NO3/c1-2-35-29(34)24-9-4-3-7-20(24)12-15-28(33)22-8-5-6-19(16-22)10-13-23-14-11-21-17-25(30)26(31)18-27(21)32-23/h3-11,13-14,16-18,28,33H,2,12,15H2,1H3/b13-10+.
What are the key properties of ethyl 2-[3-[3-[(E)-2-(6,7-difluoroquinolin-2-yl)ethenyl]phenyl]-3-hydroxypropyl]benzoate?
ethyl 2-[3-[3-[(E)-2-(6,7-difluoroquinolin-2-yl)ethenyl]phenyl]-3-hydroxypropyl]benzoate has a molecular weight of 473.52 g/mol, XLogP of 6.53, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[3-[3-[(E)-2-(6,7-difluoroquinolin-2-yl)ethenyl]phenyl]-3-hydroxypropyl]benzoate is sourced from PubChem (CID 67646788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).