C18H24F2 — CID 67647115
1,5-difluoro-6-(4-methylcyclohexa-2,4-dien-1-yl)-6-pentylcyclohexa-1,3-diene (PubChem CID 67647115) has the molecular formula C18H24F2 and a molecular weight of 278.39 g/mol. Its IUPAC name is 1,5-difluoro-6-(4-methylcyclohexa-2,4-dien-1-yl)-6-pentylcyclohexa-1,3-diene.
| Compound Name | 1,5-difluoro-6-(4-methylcyclohexa-2,4-dien-1-yl)-6-pentylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 67647115 |
| Molecular Formula | C18H24F2 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 1,5-difluoro-6-(4-methylcyclohexa-2,4-dien-1-yl)-6-pentylcyclohexa-1,3-diene |
| SMILES | CCCCCC1(C2C=CC(C)=CC2)C(F)=CC=CC1F |
| InChI | InChI=1S/C18H24F2/c1-3-4-5-13-18(15-11-9-14(2)10-12-15)16(19)7-6-8-17(18)20/h6-11,15-16H,3-5,12-13H2,1-2H3 |
| InChIKey | MMYAIKFANPCSBB-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|