C13H22O7 — CID 67647297
(2R)-2-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxypropanoic acid (PubChem CID 67647297) has the molecular formula C13H22O7 and a molecular weight of 290.31 g/mol. Its IUPAC name is (2R)-2-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxypropanoic acid.
| Compound Name | (2R)-2-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 67647297 |
| Molecular Formula | C13H22O7 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | (2R)-2-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxypropanoic acid |
| SMILES | CC1(C)OC[C@H]([C@H]2OC(C)(C)O[C@@H]2[C@@](C)(O)C(=O)O)O1 |
| InChI | InChI=1S/C13H22O7/c1-11(2)17-6-7(18-11)8-9(13(5,16)10(14)15)20-12(3,4)19-8/h7-9,16H,6H2,1-5H3,(H,14,15)/t7-,8-,9+,13-/m1/s1 |
| InChIKey | KGIXQZVTEQKLJS-RVBSWOSCSA-N |
| XLogP | 0.49 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |