C25H37NO8 — CID 67647397
7-O-tert-butyl 1-O,1-O-diethyl 2-amino-1-benzoyloxyheptane-1,1,7-tricarboxylate (PubChem CID 67647397) has the molecular formula C25H37NO8 and a molecular weight of 479.57 g/mol. Its IUPAC name is 7-O-tert-butyl 1-O,1-O-diethyl 2-amino-1-benzoyloxyheptane-1,1,7-tricarboxylate.
| Compound Name | 7-O-tert-butyl 1-O,1-O-diethyl 2-amino-1-benzoyloxyheptane-1,1,7-tricarboxylate |
|---|---|
| PubChem CID | 67647397 |
| Molecular Formula | C25H37NO8 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | 7-O-tert-butyl 1-O,1-O-diethyl 2-amino-1-benzoyloxyheptane-1,1,7-tricarboxylate |
| SMILES | CCOC(=O)C(OC(=O)c1ccccc1)(C(=O)OCC)C(N)CCCCCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H37NO8/c1-6-31-22(29)25(23(30)32-7-2,34-21(28)18-14-10-8-11-15-18)19(26)16-12-9-13-17-20(27)33-24(3,4)5/h8,10-11,14-15,19H,6-7,9,12-13,16-17,26H2,1-5H3 |
| InChIKey | RIKVQZKQXSMGDB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|