About (E)-N-[3-(cyclopropylamino)propyl]-N'-[3-[cyclopropyl(methyl)amino]propyl]but-2-ene-1,4-diamine
(E)-N-[3-(cyclopropylamino)propyl]-N'-[3-[cyclopropyl(methyl)amino]propyl]but-2-ene-1,4-diamine (PubChem CID 67647532) has the molecular formula C17H34N4
and a molecular weight of 294.49 g/mol. Its IUPAC name is (E)-N-[3-(cyclopropylamino)propyl]-N'-[3-[cyclopropyl(methyl)amino]propyl]but-2-ene-1,4-diamine.
Molecular Properties
| Compound Name | (E)-N-[3-(cyclopropylamino)propyl]-N'-[3-[cyclopropyl(methyl)amino]propyl]but-2-ene-1,4-diamine |
| PubChem CID | 67647532 |
| Molecular Formula | C17H34N4 |
| Molecular Weight | 294.49 g/mol |
| Exact Mass | 294.28 |
| IUPAC Name | (E)-N-[3-(cyclopropylamino)propyl]-N'-[3-[cyclopropyl(methyl)amino]propyl]but-2-ene-1,4-diamine |
| SMILES | CN(CCCNC/C=C/CNCCCNC1CC1)C1CC1 |
| InChI | InChI=1S/C17H34N4/c1-21(17-8-9-17)15-5-13-19-11-3-2-10-18-12-4-14-20-16-6-7-16/h2-3,16-20H,4-15H2,1H3/b3-2+ |
| InChIKey | SEEVKZJOWBUPNR-NSCUHMNNSA-N |
| XLogP | 1.35 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.49 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-[3-(cyclopropylamino)propyl]-N'-[3-[cyclopropyl(methyl)amino]propyl]but-2-ene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-[3-(cyclopropylamino)propyl]-N'-[3-[cyclopropyl(methyl)amino]propyl]but-2-ene-1,4-diamine?
The IUPAC name of (E)-N-[3-(cyclopropylamino)propyl]-N'-[3-[cyclopropyl(methyl)amino]propyl]but-2-ene-1,4-diamine (CID 67647532) is (E)-N-[3-(cyclopropylamino)propyl]-N'-[3-[cyclopropyl(methyl)amino]propyl]but-2-ene-1,4-diamine.
What is the SMILES notation for (E)-N-[3-(cyclopropylamino)propyl]-N'-[3-[cyclopropyl(methyl)amino]propyl]but-2-ene-1,4-diamine?
The canonical SMILES for (E)-N-[3-(cyclopropylamino)propyl]-N'-[3-[cyclopropyl(methyl)amino]propyl]but-2-ene-1,4-diamine is CN(CCCNC/C=C/CNCCCNC1CC1)C1CC1.
What is the InChIKey of (E)-N-[3-(cyclopropylamino)propyl]-N'-[3-[cyclopropyl(methyl)amino]propyl]but-2-ene-1,4-diamine?
The InChIKey is SEEVKZJOWBUPNR-NSCUHMNNSA-N. The full InChI is InChI=1S/C17H34N4/c1-21(17-8-9-17)15-5-13-19-11-3-2-10-18-12-4-14-20-16-6-7-16/h2-3,16-20H,4-15H2,1H3/b3-2+.
What are the key properties of (E)-N-[3-(cyclopropylamino)propyl]-N'-[3-[cyclopropyl(methyl)amino]propyl]but-2-ene-1,4-diamine?
(E)-N-[3-(cyclopropylamino)propyl]-N'-[3-[cyclopropyl(methyl)amino]propyl]but-2-ene-1,4-diamine has a molecular weight of 294.49 g/mol, XLogP of 1.35, 14 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-[3-(cyclopropylamino)propyl]-N'-[3-[cyclopropyl(methyl)amino]propyl]but-2-ene-1,4-diamine is sourced from PubChem (CID 67647532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).