C26H40N4O2 — CID 67648627
(3S,5R,8R,9S,10S,13S,14S)-3-[3-(1H-imidazol-2-ylhydrazinylidene)-2-methylprop-1-enyl]-10,13-dimethyl-2,4,5,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,14-diol (PubChem CID 67648627) has the molecular formula C26H40N4O2 and a molecular weight of 440.63 g/mol. Its IUPAC name is (3S,5R,8R,9S,10S,13S,14S)-3-[3-(1H-imidazol-2-ylhydrazinylidene)-2-methylprop-1-enyl]-10,13-dimethyl-2,4,5,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,14-diol.
| Compound Name | (3S,5R,8R,9S,10S,13S,14S)-3-[3-(1H-imidazol-2-ylhydrazinylidene)-2-methylprop-1-enyl]-10,13-dimethyl-2,4,5,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,14-diol |
|---|---|
| PubChem CID | 67648627 |
| Molecular Formula | C26H40N4O2 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.32 |
| IUPAC Name | (3S,5R,8R,9S,10S,13S,14S)-3-[3-(1H-imidazol-2-ylhydrazinylidene)-2-methylprop-1-enyl]-10,13-dimethyl-2,4,5,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,14-diol |
| SMILES | CC(C=NNc1ncc[nH]1)=C[C@]1(O)CC[C@@]2(C)[C@H](CC[C@@H]3[C@@H]2CC[C@]2(C)CCC[C@]32O)C1 |
| InChI | InChI=1S/C26H40N4O2/c1-18(17-29-30-22-27-13-14-28-22)15-25(31)12-11-24(3)19(16-25)5-6-21-20(24)7-10-23(2)8-4-9-26(21,23)32/h13-15,17,19-21,31-32H,4-12,16H2,1-3H3,(H2,27,28,30)/t19-,20+,21-,23+,24+,25-,26+/m1/s1 |
| InChIKey | XYRZAHZYBZJEAO-ORVNRVHKSA-N |
| XLogP | 5.03 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|