About 1-cycloundec-5-en-1-yl-1,2-diazacycloundec-5-ene
1-cycloundec-5-en-1-yl-1,2-diazacycloundec-5-ene (PubChem CID 67649104) has the molecular formula C20H36N2
and a molecular weight of 304.52 g/mol. Its IUPAC name is 1-cycloundec-5-en-1-yl-1,2-diazacycloundec-5-ene.
Molecular Properties
| Compound Name | 1-cycloundec-5-en-1-yl-1,2-diazacycloundec-5-ene |
| PubChem CID | 67649104 |
| Molecular Formula | C20H36N2 |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.29 |
| IUPAC Name | 1-cycloundec-5-en-1-yl-1,2-diazacycloundec-5-ene |
| SMILES | C1=CCCCC(N2CCCCCC=CCCN2)CCCCC1 |
| InChI | InChI=1S/C20H36N2/c1-2-5-9-13-17-20(16-12-8-4-1)22-19-15-11-7-3-6-10-14-18-21-22/h1,4,6,10,20-21H,2-3,5,7-9,11-19H2 |
| InChIKey | YYVGSYAZSCATRZ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-cycloundec-5-en-1-yl-1,2-diazacycloundec-5-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cycloundec-5-en-1-yl-1,2-diazacycloundec-5-ene?
The IUPAC name of 1-cycloundec-5-en-1-yl-1,2-diazacycloundec-5-ene (CID 67649104) is 1-cycloundec-5-en-1-yl-1,2-diazacycloundec-5-ene.
What is the SMILES notation for 1-cycloundec-5-en-1-yl-1,2-diazacycloundec-5-ene?
The canonical SMILES for 1-cycloundec-5-en-1-yl-1,2-diazacycloundec-5-ene is C1=CCCCC(N2CCCCCC=CCCN2)CCCCC1.
What is the InChIKey of 1-cycloundec-5-en-1-yl-1,2-diazacycloundec-5-ene?
The InChIKey is YYVGSYAZSCATRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H36N2/c1-2-5-9-13-17-20(16-12-8-4-1)22-19-15-11-7-3-6-10-14-18-21-22/h1,4,6,10,20-21H,2-3,5,7-9,11-19H2.
What are the key properties of 1-cycloundec-5-en-1-yl-1,2-diazacycloundec-5-ene?
1-cycloundec-5-en-1-yl-1,2-diazacycloundec-5-ene has a molecular weight of 304.52 g/mol, XLogP of 5.37, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cycloundec-5-en-1-yl-1,2-diazacycloundec-5-ene is sourced from PubChem (CID 67649104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).