About 1-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-hydroxythiolan-2-yl]ethanone
1-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-hydroxythiolan-2-yl]ethanone (PubChem CID 67649511) has the molecular formula C23H30O3SSi
and a molecular weight of 414.64 g/mol. Its IUPAC name is 1-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-hydroxythiolan-2-yl]ethanone.
Molecular Properties
| Compound Name | 1-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-hydroxythiolan-2-yl]ethanone |
| PubChem CID | 67649511 |
| Molecular Formula | C23H30O3SSi |
| Molecular Weight | 414.64 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 1-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-hydroxythiolan-2-yl]ethanone |
| SMILES | CC(=O)[C@@]1(O)CC[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)S1 |
| InChI | InChI=1S/C23H30O3SSi/c1-18(24)23(25)16-15-19(27-23)17-26-28(22(2,3)4,20-11-7-5-8-12-20)21-13-9-6-10-14-21/h5-14,19,25H,15-17H2,1-4H3/t19-,23-/m1/s1 |
| InChIKey | BYDGZJDMZFCWQJ-AUSIDOKSSA-N |
| XLogP | 3.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.64 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-hydroxythiolan-2-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-hydroxythiolan-2-yl]ethanone?
The IUPAC name of 1-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-hydroxythiolan-2-yl]ethanone (CID 67649511) is 1-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-hydroxythiolan-2-yl]ethanone.
What is the SMILES notation for 1-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-hydroxythiolan-2-yl]ethanone?
The canonical SMILES for 1-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-hydroxythiolan-2-yl]ethanone is CC(=O)[C@@]1(O)CC[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)S1.
What is the InChIKey of 1-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-hydroxythiolan-2-yl]ethanone?
The InChIKey is BYDGZJDMZFCWQJ-AUSIDOKSSA-N. The full InChI is InChI=1S/C23H30O3SSi/c1-18(24)23(25)16-15-19(27-23)17-26-28(22(2,3)4,20-11-7-5-8-12-20)21-13-9-6-10-14-21/h5-14,19,25H,15-17H2,1-4H3/t19-,23-/m1/s1.
What are the key properties of 1-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-hydroxythiolan-2-yl]ethanone?
1-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-hydroxythiolan-2-yl]ethanone has a molecular weight of 414.64 g/mol, XLogP of 3.74, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-hydroxythiolan-2-yl]ethanone is sourced from PubChem (CID 67649511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).