About 4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine
4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine (PubChem CID 67649794) has the molecular formula C7H9F3N2
and a molecular weight of 178.16 g/mol. Its IUPAC name is 4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine.
Molecular Properties
| Compound Name | 4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine |
| PubChem CID | 67649794 |
| Molecular Formula | C7H9F3N2 |
| Molecular Weight | 178.16 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine |
| SMILES | NC1=CCC(N)(C(F)(F)F)C=C1 |
| InChI | InChI=1S/C7H9F3N2/c8-7(9,10)6(12)3-1-5(11)2-4-6/h1-3H,4,11-12H2 |
| InChIKey | PSMDTBKTSLWKRN-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.16 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine?
The IUPAC name of 4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine (CID 67649794) is 4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine.
What is the SMILES notation for 4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine?
The canonical SMILES for 4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine is NC1=CCC(N)(C(F)(F)F)C=C1.
What is the InChIKey of 4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine?
The InChIKey is PSMDTBKTSLWKRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F3N2/c8-7(9,10)6(12)3-1-5(11)2-4-6/h1-3H,4,11-12H2.
What are the key properties of 4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine?
4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine has a molecular weight of 178.16 g/mol, XLogP of 1.05, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine is sourced from PubChem (CID 67649794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).