C21H27FN4OS — CID 67650071
3-(6-fluoro-8-thiophen-2-yl-3,4-dihydro-2H-chromen-2-yl)-1-N-(1,4,5,6-tetrahydropyrimidin-2-yl)butane-1,3-diamine (PubChem CID 67650071) has the molecular formula C21H27FN4OS and a molecular weight of 402.54 g/mol. Its IUPAC name is 3-(6-fluoro-8-thiophen-2-yl-3,4-dihydro-2H-chromen-2-yl)-1-N-(1,4,5,6-tetrahydropyrimidin-2-yl)butane-1,3-diamine.
| Compound Name | 3-(6-fluoro-8-thiophen-2-yl-3,4-dihydro-2H-chromen-2-yl)-1-N-(1,4,5,6-tetrahydropyrimidin-2-yl)butane-1,3-diamine |
|---|---|
| PubChem CID | 67650071 |
| Molecular Formula | C21H27FN4OS |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 3-(6-fluoro-8-thiophen-2-yl-3,4-dihydro-2H-chromen-2-yl)-1-N-(1,4,5,6-tetrahydropyrimidin-2-yl)butane-1,3-diamine |
| SMILES | CC(N)(CCNC1=NCCCN1)C1CCc2cc(F)cc(-c3cccs3)c2O1 |
| InChI | InChI=1S/C21H27FN4OS/c1-21(23,7-10-26-20-24-8-3-9-25-20)18-6-5-14-12-15(22)13-16(19(14)27-18)17-4-2-11-28-17/h2,4,11-13,18H,3,5-10,23H2,1H3,(H2,24,25,26) |
| InChIKey | ORVNLVFCOOADOJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |