C16H18N2O5 — CID 67650542
(E)-4-[3-(4-carbamoylpiperidin-1-yl)phenoxy]-4-oxobut-2-enoic acid (PubChem CID 67650542) has the molecular formula C16H18N2O5 and a molecular weight of 318.33 g/mol. Its IUPAC name is (E)-4-[3-(4-carbamoylpiperidin-1-yl)phenoxy]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[3-(4-carbamoylpiperidin-1-yl)phenoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 67650542 |
| Molecular Formula | C16H18N2O5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | (E)-4-[3-(4-carbamoylpiperidin-1-yl)phenoxy]-4-oxobut-2-enoic acid |
| SMILES | NC(=O)C1CCN(c2cccc(OC(=O)/C=C/C(=O)O)c2)CC1 |
| InChI | InChI=1S/C16H18N2O5/c17-16(22)11-6-8-18(9-7-11)12-2-1-3-13(10-12)23-15(21)5-4-14(19)20/h1-5,10-11H,6-9H2,(H2,17,22)(H,19,20)/b5-4+ |
| InChIKey | QDZVCKMXFDJBMT-SNAWJCMRSA-N |
| XLogP | 0.93 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|