C17H32ClN5 — CID 67651059
1-butyl-6-chloro-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-2H-1,3,5-triazin-2-amine (PubChem CID 67651059) has the molecular formula C17H32ClN5 and a molecular weight of 341.93 g/mol. Its IUPAC name is 1-butyl-6-chloro-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-2H-1,3,5-triazin-2-amine.
| Compound Name | 1-butyl-6-chloro-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-2H-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 67651059 |
| Molecular Formula | C17H32ClN5 |
| Molecular Weight | 341.93 g/mol |
| Exact Mass | 341.23 |
| IUPAC Name | 1-butyl-6-chloro-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-2H-1,3,5-triazin-2-amine |
| SMILES | CCCCN1C(Cl)=NC=NC1NC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C17H32ClN5/c1-7-8-9-23-14(18)19-12-20-15(23)21-13-10-16(2,3)22(6)17(4,5)11-13/h12-13,15,21H,7-11H2,1-6H3 |
| InChIKey | VRDAVEJHUKCOTN-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 43.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.93 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|