C14H25N3O2 — CID 67651612
tert-butyl (5aS,9aR)-2-amino-3,5,5a,6,7,8,9,9a-octahydro-1,4-benzodiazepine-4-carboxylate (PubChem CID 67651612) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is tert-butyl (5aS,9aR)-2-amino-3,5,5a,6,7,8,9,9a-octahydro-1,4-benzodiazepine-4-carboxylate.
| Compound Name | tert-butyl (5aS,9aR)-2-amino-3,5,5a,6,7,8,9,9a-octahydro-1,4-benzodiazepine-4-carboxylate |
|---|---|
| PubChem CID | 67651612 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | tert-butyl (5aS,9aR)-2-amino-3,5,5a,6,7,8,9,9a-octahydro-1,4-benzodiazepine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(N)=N[C@@H]2CCCC[C@H]2C1 |
| InChI | InChI=1S/C14H25N3O2/c1-14(2,3)19-13(18)17-8-10-6-4-5-7-11(10)16-12(15)9-17/h10-11H,4-9H2,1-3H3,(H2,15,16)/t10-,11+/m0/s1 |
| InChIKey | BZXLFVLZIPLJGM-WDEREUQCSA-N |
| XLogP | 2.15 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |