C17H25N3O5S — CID 67652168
1-[(2R)-3-phenyl-2-(propan-2-ylsulfamoylamino)propanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 67652168) has the molecular formula C17H25N3O5S and a molecular weight of 383.47 g/mol. Its IUPAC name is 1-[(2R)-3-phenyl-2-(propan-2-ylsulfamoylamino)propanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[(2R)-3-phenyl-2-(propan-2-ylsulfamoylamino)propanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 67652168 |
| Molecular Formula | C17H25N3O5S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 1-[(2R)-3-phenyl-2-(propan-2-ylsulfamoylamino)propanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(C)NS(=O)(=O)N[C@H](Cc1ccccc1)C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C17H25N3O5S/c1-12(2)18-26(24,25)19-14(11-13-7-4-3-5-8-13)16(21)20-10-6-9-15(20)17(22)23/h3-5,7-8,12,14-15,18-19H,6,9-11H2,1-2H3,(H,22,23)/t14-,15?/m1/s1 |
| InChIKey | LCYRZOPUUOCJPK-GICMACPYSA-N |
| XLogP | 0.51 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |