C46H64N4 — CID 67652343
2,3,7,8,12,13,17,18-octaethyl-5,15-dipentylporphyrin (PubChem CID 67652343) has the molecular formula C46H64N4 and a molecular weight of 673.05 g/mol. Its IUPAC name is 2,3,7,8,12,13,17,18-octaethyl-5,15-dipentylporphyrin.
| Compound Name | 2,3,7,8,12,13,17,18-octaethyl-5,15-dipentylporphyrin |
|---|---|
| PubChem CID | 67652343 |
| Molecular Formula | C46H64N4 |
| Molecular Weight | 673.05 g/mol |
| Exact Mass | 672.51 |
| IUPAC Name | 2,3,7,8,12,13,17,18-octaethyl-5,15-dipentylporphyrin |
| SMILES | CCCCC/C1=C2/N=C(/C=C3\N=C(C(CC)=C3CC)/C(CCCCC)=C3\N=C(/C=C4\N=C1C(CC)=C4CC)C(CC)=C3CC)C(CC)=C2CC |
| InChI | InChI=1S/C46H64N4/c1-11-21-23-25-37-43-33(17-7)29(13-3)39(47-43)27-41-31(15-5)35(19-9)45(49-41)38(26-24-22-12-2)46-36(20-10)32(16-6)42(50-46)28-40-30(14-4)34(18-8)44(37)48-40/h27-28H,11-26H2,1-10H3/b39-27-,40-28-,41-27-,42-28-,43-37-,44-37-,45-38-,46-38- |
| InChIKey | UGWKFPFJVXRZLK-ZVOGILCNSA-N |
| XLogP | 13.72 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.05 |
| LogP ≤ 5 | 13.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|