C30H35ClO4 — CID 67652361
(4aR,4bS,5S,6aS,10aS,10bR)-5-(4-acetylphenyl)-8-chloro-7-hydroxy-7-[(Z)-3-hydroxyprop-1-enyl]-6a-methyl-4,4a,4b,5,6,10,10a,10b,11,12-decahydro-3H-chrysen-2-one (PubChem CID 67652361) has the molecular formula C30H35ClO4 and a molecular weight of 495.06 g/mol. Its IUPAC name is (4aR,4bS,5S,6aS,10aS,10bR)-5-(4-acetylphenyl)-8-chloro-7-hydroxy-7-[(Z)-3-hydroxyprop-1-enyl]-6a-methyl-4,4a,4b,5,6,10,10a,10b,11,12-decahydro-3H-chrysen-2-one.
| Compound Name | (4aR,4bS,5S,6aS,10aS,10bR)-5-(4-acetylphenyl)-8-chloro-7-hydroxy-7-[(Z)-3-hydroxyprop-1-enyl]-6a-methyl-4,4a,4b,5,6,10,10a,10b,11,12-decahydro-3H-chrysen-2-one |
|---|---|
| PubChem CID | 67652361 |
| Molecular Formula | C30H35ClO4 |
| Molecular Weight | 495.06 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | (4aR,4bS,5S,6aS,10aS,10bR)-5-(4-acetylphenyl)-8-chloro-7-hydroxy-7-[(Z)-3-hydroxyprop-1-enyl]-6a-methyl-4,4a,4b,5,6,10,10a,10b,11,12-decahydro-3H-chrysen-2-one |
| SMILES | CC(=O)c1ccc([C@H]2C[C@@]3(C)[C@@H](CC=C(Cl)C3(O)/C=C\CO)[C@@H]3CCC4=CC(=O)CC[C@@H]4[C@H]32)cc1 |
| InChI | InChI=1S/C30H35ClO4/c1-18(33)19-4-6-20(7-5-19)25-17-29(2)26(12-13-27(31)30(29,35)14-3-15-32)24-10-8-21-16-22(34)9-11-23(21)28(24)25/h3-7,13-14,16,23-26,28,32,35H,8-12,15,17H2,1-2H3/b14-3-/t23-,24-,25+,26-,28+,29-,30?/m0/s1 |
| InChIKey | DKKJEMXFNDICKZ-IACFWABASA-N |
| XLogP | 5.74 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.06 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|