About spiro[2.10]tridecane-13,13-diol
spiro[2.10]tridecane-13,13-diol (PubChem CID 67652572) has the molecular formula C13H24O2
and a molecular weight of 212.33 g/mol. Its IUPAC name is spiro[2.10]tridecane-13,13-diol.
Molecular Properties
| Compound Name | spiro[2.10]tridecane-13,13-diol |
| PubChem CID | 67652572 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | spiro[2.10]tridecane-13,13-diol |
| SMILES | OC1(O)CCCCCCCCCC12CC2 |
| InChI | InChI=1S/C13H24O2/c14-13(15)9-7-5-3-1-2-4-6-8-12(13)10-11-12/h14-15H,1-11H2 |
| InChIKey | KWMDRKJFLJYUJC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze spiro[2.10]tridecane-13,13-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[2.10]tridecane-13,13-diol?
The IUPAC name of spiro[2.10]tridecane-13,13-diol (CID 67652572) is spiro[2.10]tridecane-13,13-diol.
What is the SMILES notation for spiro[2.10]tridecane-13,13-diol?
The canonical SMILES for spiro[2.10]tridecane-13,13-diol is OC1(O)CCCCCCCCCC12CC2.
What is the InChIKey of spiro[2.10]tridecane-13,13-diol?
The InChIKey is KWMDRKJFLJYUJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O2/c14-13(15)9-7-5-3-1-2-4-6-8-12(13)10-11-12/h14-15H,1-11H2.
What are the key properties of spiro[2.10]tridecane-13,13-diol?
spiro[2.10]tridecane-13,13-diol has a molecular weight of 212.33 g/mol, XLogP of 2.97, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[2.10]tridecane-13,13-diol is sourced from PubChem (CID 67652572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).