C21H20F3N3O6 — CID 67652657
2-[4-(4-carbamimidoylphenyl)-3-methoxy-1-oxo-3,4-dihydroisoquinolin-2-yl]acetic acid;2,2,2-trifluoroacetic acid (PubChem CID 67652657) has the molecular formula C21H20F3N3O6 and a molecular weight of 467.40 g/mol. Its IUPAC name is 2-[4-(4-carbamimidoylphenyl)-3-methoxy-1-oxo-3,4-dihydroisoquinolin-2-yl]acetic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[4-(4-carbamimidoylphenyl)-3-methoxy-1-oxo-3,4-dihydroisoquinolin-2-yl]acetic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67652657 |
| Molecular Formula | C21H20F3N3O6 |
| Molecular Weight | 467.40 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 2-[4-(4-carbamimidoylphenyl)-3-methoxy-1-oxo-3,4-dihydroisoquinolin-2-yl]acetic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(C2c3ccccc3C(=O)N(CC(=O)O)C2OC)cc1 |
| InChI | InChI=1S/C19H19N3O4.C2HF3O2/c1-26-19-16(11-6-8-12(9-7-11)17(20)21)13-4-2-3-5-14(13)18(25)22(19)10-15(23)24;3-2(4,5)1(6)7/h2-9,16,19H,10H2,1H3,(H3,20,21)(H,23,24);(H,6,7) |
| InChIKey | SASXYUKJASDXNG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 154.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|