4-hexyl-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid

C15H23NO4 — CID 67652768

IUPAC4-hexyl-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid
SMILESCCCCCCC1C(C(=O)O)=C(C)NC(C)=C1C(=O)O
InChIInChI=1S/C15H23NO4/c1-4-5-6-7-8-11-12(14(17)18)9(2)16-10(3)13(11)15(19)20/h11,16H,4-8H2,1-3H3,(H,17,18)(H,19,20)
InChIKeyXZCAITHFZCYGJM-UHFFFAOYSA-N
MW281.35 g/mol
LogP2.89
Rot. Bonds7

About 4-hexyl-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid

4-hexyl-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid (PubChem CID 67652768) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is 4-hexyl-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid.

Molecular Properties

Compound Name4-hexyl-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid
PubChem CID67652768
Molecular FormulaC15H23NO4
Molecular Weight281.35 g/mol
Exact Mass281.16
IUPAC Name4-hexyl-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid
SMILESCCCCCCC1C(C(=O)O)=C(C)NC(C)=C1C(=O)O
InChIInChI=1S/C15H23NO4/c1-4-5-6-7-8-11-12(14(17)18)9(2)16-10(3)13(11)15(19)20/h11,16H,4-8H2,1-3H3,(H,17,18)(H,19,20)
InChIKeyXZCAITHFZCYGJM-UHFFFAOYSA-N
XLogP2.89
TPSA86.63 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.35
LogP ≤ 52.89
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-hexyl-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-hexyl-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid?
The IUPAC name of 4-hexyl-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid (CID 67652768) is 4-hexyl-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid.
What is the SMILES notation for 4-hexyl-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid?
The canonical SMILES for 4-hexyl-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid is CCCCCCC1C(C(=O)O)=C(C)NC(C)=C1C(=O)O.
What is the InChIKey of 4-hexyl-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid?
The InChIKey is XZCAITHFZCYGJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO4/c1-4-5-6-7-8-11-12(14(17)18)9(2)16-10(3)13(11)15(19)20/h11,16H,4-8H2,1-3H3,(H,17,18)(H,19,20).
What are the key properties of 4-hexyl-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid?
4-hexyl-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid has a molecular weight of 281.35 g/mol, XLogP of 2.89, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hexyl-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid is sourced from PubChem (CID 67652768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).