C30H34BrP — CID 67653243
13-[(2R)-butan-2-yl]-13-[(2S)-butan-2-yl]-13-phosphoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene bromide (PubChem CID 67653243) has the molecular formula C30H34BrP and a molecular weight of 505.48 g/mol. Its IUPAC name is 13-[(2R)-butan-2-yl]-13-[(2S)-butan-2-yl]-13-phosphoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene bromide.
| Compound Name | 13-[(2R)-butan-2-yl]-13-[(2S)-butan-2-yl]-13-phosphoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene bromide |
|---|---|
| PubChem CID | 67653243 |
| Molecular Formula | C30H34BrP |
| Molecular Weight | 505.48 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | 13-[(2R)-butan-2-yl]-13-[(2S)-butan-2-yl]-13-phosphoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene bromide |
| SMILES | CC[C@@H](C)[P+]1([C@@H](C)CC)Cc2ccc3ccccc3c2-c2c(ccc3ccccc23)C1.[Br-] |
| InChI | InChI=1S/C30H34P.BrH/c1-5-21(3)31(22(4)6-2)19-25-17-15-23-11-7-9-13-27(23)29(25)30-26(20-31)18-16-24-12-8-10-14-28(24)30;/h7-18,21-22H,5-6,19-20H2,1-4H3;1H/q+1;/p-1/t21-,22+; |
| InChIKey | PTFFYQRLPNQQMR-WHXBIKBMSA-M |
| XLogP | 6.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.48 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|