About 4-[4-[1,1-bis(4-hydroxy-3-methylphenyl)ethyl]-2-propan-2-ylphenyl]-2-methylphenol
4-[4-[1,1-bis(4-hydroxy-3-methylphenyl)ethyl]-2-propan-2-ylphenyl]-2-methylphenol (PubChem CID 67653349) has the molecular formula C32H34O3
and a molecular weight of 466.62 g/mol. Its IUPAC name is 4-[4-[1,1-bis(4-hydroxy-3-methylphenyl)ethyl]-2-propan-2-ylphenyl]-2-methylphenol.
Molecular Properties
| Compound Name | 4-[4-[1,1-bis(4-hydroxy-3-methylphenyl)ethyl]-2-propan-2-ylphenyl]-2-methylphenol |
| PubChem CID | 67653349 |
| Molecular Formula | C32H34O3 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | 4-[4-[1,1-bis(4-hydroxy-3-methylphenyl)ethyl]-2-propan-2-ylphenyl]-2-methylphenol |
| SMILES | Cc1cc(-c2ccc(C(C)(c3ccc(O)c(C)c3)c3ccc(O)c(C)c3)cc2C(C)C)ccc1O |
| InChI | InChI=1S/C32H34O3/c1-19(2)28-18-26(8-11-27(28)23-7-12-29(33)20(3)15-23)32(6,24-9-13-30(34)21(4)16-24)25-10-14-31(35)22(5)17-25/h7-19,33-35H,1-6H3 |
| InChIKey | FVZBIYBMPRHMSW-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-[1,1-bis(4-hydroxy-3-methylphenyl)ethyl]-2-propan-2-ylphenyl]-2-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[1,1-bis(4-hydroxy-3-methylphenyl)ethyl]-2-propan-2-ylphenyl]-2-methylphenol?
The IUPAC name of 4-[4-[1,1-bis(4-hydroxy-3-methylphenyl)ethyl]-2-propan-2-ylphenyl]-2-methylphenol (CID 67653349) is 4-[4-[1,1-bis(4-hydroxy-3-methylphenyl)ethyl]-2-propan-2-ylphenyl]-2-methylphenol.
What is the SMILES notation for 4-[4-[1,1-bis(4-hydroxy-3-methylphenyl)ethyl]-2-propan-2-ylphenyl]-2-methylphenol?
The canonical SMILES for 4-[4-[1,1-bis(4-hydroxy-3-methylphenyl)ethyl]-2-propan-2-ylphenyl]-2-methylphenol is Cc1cc(-c2ccc(C(C)(c3ccc(O)c(C)c3)c3ccc(O)c(C)c3)cc2C(C)C)ccc1O.
What is the InChIKey of 4-[4-[1,1-bis(4-hydroxy-3-methylphenyl)ethyl]-2-propan-2-ylphenyl]-2-methylphenol?
The InChIKey is FVZBIYBMPRHMSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H34O3/c1-19(2)28-18-26(8-11-27(28)23-7-12-29(33)20(3)15-23)32(6,24-9-13-30(34)21(4)16-24)25-10-14-31(35)22(5)17-25/h7-19,33-35H,1-6H3.
What are the key properties of 4-[4-[1,1-bis(4-hydroxy-3-methylphenyl)ethyl]-2-propan-2-ylphenyl]-2-methylphenol?
4-[4-[1,1-bis(4-hydroxy-3-methylphenyl)ethyl]-2-propan-2-ylphenyl]-2-methylphenol has a molecular weight of 466.62 g/mol, XLogP of 7.87, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[1,1-bis(4-hydroxy-3-methylphenyl)ethyl]-2-propan-2-ylphenyl]-2-methylphenol is sourced from PubChem (CID 67653349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).