About 2-methyl-3,5-bis(prop-2-enyl)pyridine
2-methyl-3,5-bis(prop-2-enyl)pyridine (PubChem CID 67653617) has the molecular formula C12H15N
and a molecular weight of 173.26 g/mol. Its IUPAC name is 2-methyl-3,5-bis(prop-2-enyl)pyridine.
Molecular Properties
| Compound Name | 2-methyl-3,5-bis(prop-2-enyl)pyridine |
| PubChem CID | 67653617 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 2-methyl-3,5-bis(prop-2-enyl)pyridine |
| SMILES | C=CCc1cnc(C)c(CC=C)c1 |
| InChI | InChI=1S/C12H15N/c1-4-6-11-8-12(7-5-2)10(3)13-9-11/h4-5,8-9H,1-2,6-7H2,3H3 |
| InChIKey | FRZJXRTZGVXYPG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3,5-bis(prop-2-enyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3,5-bis(prop-2-enyl)pyridine?
The IUPAC name of 2-methyl-3,5-bis(prop-2-enyl)pyridine (CID 67653617) is 2-methyl-3,5-bis(prop-2-enyl)pyridine.
What is the SMILES notation for 2-methyl-3,5-bis(prop-2-enyl)pyridine?
The canonical SMILES for 2-methyl-3,5-bis(prop-2-enyl)pyridine is C=CCc1cnc(C)c(CC=C)c1.
What is the InChIKey of 2-methyl-3,5-bis(prop-2-enyl)pyridine?
The InChIKey is FRZJXRTZGVXYPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N/c1-4-6-11-8-12(7-5-2)10(3)13-9-11/h4-5,8-9H,1-2,6-7H2,3H3.
What are the key properties of 2-methyl-3,5-bis(prop-2-enyl)pyridine?
2-methyl-3,5-bis(prop-2-enyl)pyridine has a molecular weight of 173.26 g/mol, XLogP of 2.85, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3,5-bis(prop-2-enyl)pyridine is sourced from PubChem (CID 67653617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).