About 1-propyl-2-[5-(1,2,4-triazol-4-yl)-1H-indol-3-yl]piperidin-4-amine
1-propyl-2-[5-(1,2,4-triazol-4-yl)-1H-indol-3-yl]piperidin-4-amine (PubChem CID 67653680) has the molecular formula C18H24N6
and a molecular weight of 324.43 g/mol. Its IUPAC name is 1-propyl-2-[5-(1,2,4-triazol-4-yl)-1H-indol-3-yl]piperidin-4-amine.
Molecular Properties
| Compound Name | 1-propyl-2-[5-(1,2,4-triazol-4-yl)-1H-indol-3-yl]piperidin-4-amine |
| PubChem CID | 67653680 |
| Molecular Formula | C18H24N6 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | 1-propyl-2-[5-(1,2,4-triazol-4-yl)-1H-indol-3-yl]piperidin-4-amine |
| SMILES | CCCN1CCC(N)CC1c1c[nH]c2ccc(-n3cnnc3)cc12 |
| InChI | InChI=1S/C18H24N6/c1-2-6-23-7-5-13(19)8-18(23)16-10-20-17-4-3-14(9-15(16)17)24-11-21-22-12-24/h3-4,9-13,18,20H,2,5-8,19H2,1H3 |
| InChIKey | VLNOZNJBPFILIJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-propyl-2-[5-(1,2,4-triazol-4-yl)-1H-indol-3-yl]piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propyl-2-[5-(1,2,4-triazol-4-yl)-1H-indol-3-yl]piperidin-4-amine?
The IUPAC name of 1-propyl-2-[5-(1,2,4-triazol-4-yl)-1H-indol-3-yl]piperidin-4-amine (CID 67653680) is 1-propyl-2-[5-(1,2,4-triazol-4-yl)-1H-indol-3-yl]piperidin-4-amine.
What is the SMILES notation for 1-propyl-2-[5-(1,2,4-triazol-4-yl)-1H-indol-3-yl]piperidin-4-amine?
The canonical SMILES for 1-propyl-2-[5-(1,2,4-triazol-4-yl)-1H-indol-3-yl]piperidin-4-amine is CCCN1CCC(N)CC1c1c[nH]c2ccc(-n3cnnc3)cc12.
What is the InChIKey of 1-propyl-2-[5-(1,2,4-triazol-4-yl)-1H-indol-3-yl]piperidin-4-amine?
The InChIKey is VLNOZNJBPFILIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N6/c1-2-6-23-7-5-13(19)8-18(23)16-10-20-17-4-3-14(9-15(16)17)24-11-21-22-12-24/h3-4,9-13,18,20H,2,5-8,19H2,1H3.
What are the key properties of 1-propyl-2-[5-(1,2,4-triazol-4-yl)-1H-indol-3-yl]piperidin-4-amine?
1-propyl-2-[5-(1,2,4-triazol-4-yl)-1H-indol-3-yl]piperidin-4-amine has a molecular weight of 324.43 g/mol, XLogP of 2.62, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propyl-2-[5-(1,2,4-triazol-4-yl)-1H-indol-3-yl]piperidin-4-amine is sourced from PubChem (CID 67653680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).