C14H18N2O3 — CID 67653853
(4-ethenylphenyl) (2S)-5-amino-2-(methylamino)-5-oxopentanoate (PubChem CID 67653853) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is (4-ethenylphenyl) (2S)-5-amino-2-(methylamino)-5-oxopentanoate.
| Compound Name | (4-ethenylphenyl) (2S)-5-amino-2-(methylamino)-5-oxopentanoate |
|---|---|
| PubChem CID | 67653853 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | (4-ethenylphenyl) (2S)-5-amino-2-(methylamino)-5-oxopentanoate |
| SMILES | C=Cc1ccc(OC(=O)[C@H](CCC(N)=O)NC)cc1 |
| InChI | InChI=1S/C14H18N2O3/c1-3-10-4-6-11(7-5-10)19-14(18)12(16-2)8-9-13(15)17/h3-7,12,16H,1,8-9H2,2H3,(H2,15,17)/t12-/m0/s1 |
| InChIKey | ZJXLYHUNMQHFNE-LBPRGKRZSA-N |
| XLogP | 1.09 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|