C32H57BrO2Si — CID 67654011
[(2R)-5-(bromomethyl)-2,7,8-trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl]oxy-trimethylsilane (PubChem CID 67654011) has the molecular formula C32H57BrO2Si and a molecular weight of 581.80 g/mol. Its IUPAC name is [(2R)-5-(bromomethyl)-2,7,8-trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl]oxy-trimethylsilane.
| Compound Name | [(2R)-5-(bromomethyl)-2,7,8-trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 67654011 |
| Molecular Formula | C32H57BrO2Si |
| Molecular Weight | 581.80 g/mol |
| Exact Mass | 580.33 |
| IUPAC Name | [(2R)-5-(bromomethyl)-2,7,8-trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl]oxy-trimethylsilane |
| SMILES | Cc1c(C)c(O[Si](C)(C)C)c(CBr)c2c1O[C@](C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)CC2 |
| InChI | InChI=1S/C32H57BrO2Si/c1-23(2)14-11-15-24(3)16-12-17-25(4)18-13-20-32(7)21-19-28-29(22-33)31(35-36(8,9)10)27(6)26(5)30(28)34-32/h23-25H,11-22H2,1-10H3/t24-,25-,32-/m1/s1 |
| InChIKey | SCEVHHJNKBIBIP-NCLPYWGKSA-N |
| XLogP | 10.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.80 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|