C18H10Cl3F2NO2S — CID 67654263
2-[4,5-difluoro-2-(3,4,5-trichlorophenyl)phenyl]benzenesulfonamide (PubChem CID 67654263) has the molecular formula C18H10Cl3F2NO2S and a molecular weight of 448.71 g/mol. Its IUPAC name is 2-[4,5-difluoro-2-(3,4,5-trichlorophenyl)phenyl]benzenesulfonamide.
| Compound Name | 2-[4,5-difluoro-2-(3,4,5-trichlorophenyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 67654263 |
| Molecular Formula | C18H10Cl3F2NO2S |
| Molecular Weight | 448.71 g/mol |
| Exact Mass | 446.95 |
| IUPAC Name | 2-[4,5-difluoro-2-(3,4,5-trichlorophenyl)phenyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccccc1-c1cc(F)c(F)cc1-c1cc(Cl)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H10Cl3F2NO2S/c19-13-5-9(6-14(20)18(13)21)11-7-15(22)16(23)8-12(11)10-3-1-2-4-17(10)27(24,25)26/h1-8H,(H2,24,25,26) |
| InChIKey | MTQHXGUAHMOXGN-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.71 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|