About oxan-4-ylmethyl oxane-4-carboxylate
oxan-4-ylmethyl oxane-4-carboxylate (PubChem CID 67654592) has the molecular formula C12H20O4
and a molecular weight of 228.29 g/mol. Its IUPAC name is oxan-4-ylmethyl oxane-4-carboxylate.
Molecular Properties
| Compound Name | oxan-4-ylmethyl oxane-4-carboxylate |
| PubChem CID | 67654592 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | oxan-4-ylmethyl oxane-4-carboxylate |
| SMILES | O=C(OCC1CCOCC1)C1CCOCC1 |
| InChI | InChI=1S/C12H20O4/c13-12(11-3-7-15-8-4-11)16-9-10-1-5-14-6-2-10/h10-11H,1-9H2 |
| InChIKey | LKUBHHALTGWSIZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze oxan-4-ylmethyl oxane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-4-ylmethyl oxane-4-carboxylate?
The IUPAC name of oxan-4-ylmethyl oxane-4-carboxylate (CID 67654592) is oxan-4-ylmethyl oxane-4-carboxylate.
What is the SMILES notation for oxan-4-ylmethyl oxane-4-carboxylate?
The canonical SMILES for oxan-4-ylmethyl oxane-4-carboxylate is O=C(OCC1CCOCC1)C1CCOCC1.
What is the InChIKey of oxan-4-ylmethyl oxane-4-carboxylate?
The InChIKey is LKUBHHALTGWSIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O4/c13-12(11-3-7-15-8-4-11)16-9-10-1-5-14-6-2-10/h10-11H,1-9H2.
What are the key properties of oxan-4-ylmethyl oxane-4-carboxylate?
oxan-4-ylmethyl oxane-4-carboxylate has a molecular weight of 228.29 g/mol, XLogP of 1.38, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-4-ylmethyl oxane-4-carboxylate is sourced from PubChem (CID 67654592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).