C16H29NO6 — CID 67654613
(2R)-2-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-N,N-diethyl-2-hydroxyacetamide (PubChem CID 67654613) has the molecular formula C16H29NO6 and a molecular weight of 331.41 g/mol. Its IUPAC name is (2R)-2-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-N,N-diethyl-2-hydroxyacetamide.
| Compound Name | (2R)-2-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-N,N-diethyl-2-hydroxyacetamide |
|---|---|
| PubChem CID | 67654613 |
| Molecular Formula | C16H29NO6 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | (2R)-2-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-N,N-diethyl-2-hydroxyacetamide |
| SMILES | CCN(CC)C(=O)[C@H](O)[C@H]1OC(C)(C)O[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C16H29NO6/c1-7-17(8-2)14(19)11(18)13-12(22-16(5,6)23-13)10-9-20-15(3,4)21-10/h10-13,18H,7-9H2,1-6H3/t10-,11-,12-,13-/m1/s1 |
| InChIKey | ZGHWQOWLKLRXIJ-FDYHWXHSSA-N |
| XLogP | 0.89 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |