About N-cyclopentyl-5-methyl-1,3,4-thiadiazol-2-amine
N-cyclopentyl-5-methyl-1,3,4-thiadiazol-2-amine (PubChem CID 676548) has the molecular formula C8H13N3S
and a molecular weight of 183.28 g/mol. Its IUPAC name is N-cyclopentyl-5-methyl-1,3,4-thiadiazol-2-amine.
Molecular Properties
| Compound Name | N-cyclopentyl-5-methyl-1,3,4-thiadiazol-2-amine |
| PubChem CID | 676548 |
| Molecular Formula | C8H13N3S |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | N-cyclopentyl-5-methyl-1,3,4-thiadiazol-2-amine |
| SMILES | Cc1nnc(NC2CCCC2)s1 |
| InChI | InChI=1S/C8H13N3S/c1-6-10-11-8(12-6)9-7-4-2-3-5-7/h7H,2-5H2,1H3,(H,9,11) |
| InChIKey | JLLBLKYAADMGQZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclopentyl-5-methyl-1,3,4-thiadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-5-methyl-1,3,4-thiadiazol-2-amine?
The IUPAC name of N-cyclopentyl-5-methyl-1,3,4-thiadiazol-2-amine (CID 676548) is N-cyclopentyl-5-methyl-1,3,4-thiadiazol-2-amine.
What is the SMILES notation for N-cyclopentyl-5-methyl-1,3,4-thiadiazol-2-amine?
The canonical SMILES for N-cyclopentyl-5-methyl-1,3,4-thiadiazol-2-amine is Cc1nnc(NC2CCCC2)s1.
What is the InChIKey of N-cyclopentyl-5-methyl-1,3,4-thiadiazol-2-amine?
The InChIKey is JLLBLKYAADMGQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3S/c1-6-10-11-8(12-6)9-7-4-2-3-5-7/h7H,2-5H2,1H3,(H,9,11).
What are the key properties of N-cyclopentyl-5-methyl-1,3,4-thiadiazol-2-amine?
N-cyclopentyl-5-methyl-1,3,4-thiadiazol-2-amine has a molecular weight of 183.28 g/mol, XLogP of 2.20, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-5-methyl-1,3,4-thiadiazol-2-amine is sourced from PubChem (CID 676548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).