C17H14F2INO2 — CID 67655117
2-(2,6-difluorophenyl)-4-(2-ethoxy-4-iodophenyl)-4,5-dihydro-1,3-oxazole (PubChem CID 67655117) has the molecular formula C17H14F2INO2 and a molecular weight of 429.20 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-4-(2-ethoxy-4-iodophenyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-(2,6-difluorophenyl)-4-(2-ethoxy-4-iodophenyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 67655117 |
| Molecular Formula | C17H14F2INO2 |
| Molecular Weight | 429.20 g/mol |
| Exact Mass | 429.00 |
| IUPAC Name | 2-(2,6-difluorophenyl)-4-(2-ethoxy-4-iodophenyl)-4,5-dihydro-1,3-oxazole |
| SMILES | CCOc1cc(I)ccc1C1COC(c2c(F)cccc2F)=N1 |
| InChI | InChI=1S/C17H14F2INO2/c1-2-22-15-8-10(20)6-7-11(15)14-9-23-17(21-14)16-12(18)4-3-5-13(16)19/h3-8,14H,2,9H2,1H3 |
| InChIKey | RIJNUTQAYHWIES-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.20 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|