C25H30N6 — CID 67655176
3-[1-(1-benzylpiperazin-2-yl)propyl]-5-(1,2,4-triazol-1-ylmethyl)-1H-indole (PubChem CID 67655176) has the molecular formula C25H30N6 and a molecular weight of 414.56 g/mol. Its IUPAC name is 3-[1-(1-benzylpiperazin-2-yl)propyl]-5-(1,2,4-triazol-1-ylmethyl)-1H-indole.
| Compound Name | 3-[1-(1-benzylpiperazin-2-yl)propyl]-5-(1,2,4-triazol-1-ylmethyl)-1H-indole |
|---|---|
| PubChem CID | 67655176 |
| Molecular Formula | C25H30N6 |
| Molecular Weight | 414.56 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | 3-[1-(1-benzylpiperazin-2-yl)propyl]-5-(1,2,4-triazol-1-ylmethyl)-1H-indole |
| SMILES | CCC(c1c[nH]c2ccc(Cn3cncn3)cc12)C1CNCCN1Cc1ccccc1 |
| InChI | InChI=1S/C25H30N6/c1-2-21(25-14-26-10-11-30(25)15-19-6-4-3-5-7-19)23-13-28-24-9-8-20(12-22(23)24)16-31-18-27-17-29-31/h3-9,12-13,17-18,21,25-26,28H,2,10-11,14-16H2,1H3 |
| InChIKey | WMRHXABTKBUMEX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.56 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |