About 2,8-dichloroquinoline
2,8-dichloroquinoline (PubChem CID 676553) has the molecular formula C9H5Cl2N
and a molecular weight of 198.05 g/mol. Its IUPAC name is 2,8-dichloroquinoline.
Molecular Properties
| Compound Name | 2,8-dichloroquinoline |
| PubChem CID | 676553 |
| Molecular Formula | C9H5Cl2N |
| Molecular Weight | 198.05 g/mol |
| Exact Mass | 196.98 |
| IUPAC Name | 2,8-dichloroquinoline |
| SMILES | Clc1ccc2cccc(Cl)c2n1 |
| InChI | InChI=1S/C9H5Cl2N/c10-7-3-1-2-6-4-5-8(11)12-9(6)7/h1-5H |
| InChIKey | VAXOCTXTVIVOQE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.05 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2,8-dichloroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,8-dichloroquinoline?
The IUPAC name of 2,8-dichloroquinoline (CID 676553) is 2,8-dichloroquinoline.
What is the SMILES notation for 2,8-dichloroquinoline?
The canonical SMILES for 2,8-dichloroquinoline is Clc1ccc2cccc(Cl)c2n1.
What is the InChIKey of 2,8-dichloroquinoline?
The InChIKey is VAXOCTXTVIVOQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5Cl2N/c10-7-3-1-2-6-4-5-8(11)12-9(6)7/h1-5H.
What are the key properties of 2,8-dichloroquinoline?
2,8-dichloroquinoline has a molecular weight of 198.05 g/mol, XLogP of 3.54, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8-dichloroquinoline is sourced from PubChem (CID 676553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).