C20H27NO2 — CID 67655522
2-benzyl-1-tert-butyl-1,3,3a,4,5,6-hexahydroisoindole-4-carboxylic acid (PubChem CID 67655522) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is 2-benzyl-1-tert-butyl-1,3,3a,4,5,6-hexahydroisoindole-4-carboxylic acid.
| Compound Name | 2-benzyl-1-tert-butyl-1,3,3a,4,5,6-hexahydroisoindole-4-carboxylic acid |
|---|---|
| PubChem CID | 67655522 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 2-benzyl-1-tert-butyl-1,3,3a,4,5,6-hexahydroisoindole-4-carboxylic acid |
| SMILES | CC(C)(C)C1C2=CCCC(C(=O)O)C2CN1Cc1ccccc1 |
| InChI | InChI=1S/C20H27NO2/c1-20(2,3)18-15-10-7-11-16(19(22)23)17(15)13-21(18)12-14-8-5-4-6-9-14/h4-6,8-10,16-18H,7,11-13H2,1-3H3,(H,22,23) |
| InChIKey | INJVSFHQNZHWMT-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|