C34H37N5O4 — CID 67655825
2-[2-(4-nitrophenyl)-2-oxoethylidene]-5,5-bis(pyridin-4-ylmethyl)-3-[(4,6,6-trimethyl-1-bicyclo[3.1.1]heptanyl)methyl]imidazolidin-4-one (PubChem CID 67655825) has the molecular formula C34H37N5O4 and a molecular weight of 579.70 g/mol. Its IUPAC name is 2-[2-(4-nitrophenyl)-2-oxoethylidene]-5,5-bis(pyridin-4-ylmethyl)-3-[(4,6,6-trimethyl-1-bicyclo[3.1.1]heptanyl)methyl]imidazolidin-4-one.
| Compound Name | 2-[2-(4-nitrophenyl)-2-oxoethylidene]-5,5-bis(pyridin-4-ylmethyl)-3-[(4,6,6-trimethyl-1-bicyclo[3.1.1]heptanyl)methyl]imidazolidin-4-one |
|---|---|
| PubChem CID | 67655825 |
| Molecular Formula | C34H37N5O4 |
| Molecular Weight | 579.70 g/mol |
| Exact Mass | 579.28 |
| IUPAC Name | 2-[2-(4-nitrophenyl)-2-oxoethylidene]-5,5-bis(pyridin-4-ylmethyl)-3-[(4,6,6-trimethyl-1-bicyclo[3.1.1]heptanyl)methyl]imidazolidin-4-one |
| SMILES | CC1CCC2(CN3C(=O)C(Cc4ccncc4)(Cc4ccncc4)NC3=CC(=O)c3ccc([N+](=O)[O-])cc3)CC1C2(C)C |
| InChI | InChI=1S/C34H37N5O4/c1-23-8-13-33(21-28(23)32(33,2)3)22-38-30(18-29(40)26-4-6-27(7-5-26)39(42)43)37-34(31(38)41,19-24-9-14-35-15-10-24)20-25-11-16-36-17-12-25/h4-7,9-12,14-18,23,28,37H,8,13,19-22H2,1-3H3 |
| InChIKey | VVYGDSQNDVZHMK-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 118.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.70 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|