C39H43NO3 — CID 67656169
(3S,4R,5S,6S)-6-[2-(3,5-dimethylphenyl)-1,1-diphenylethyl]-5-[(3,5-dimethylphenyl)methoxy]-1-azabicyclo[2.2.2]octane-3-carboxylic acid (PubChem CID 67656169) has the molecular formula C39H43NO3 and a molecular weight of 573.78 g/mol. Its IUPAC name is (3S,4R,5S,6S)-6-[2-(3,5-dimethylphenyl)-1,1-diphenylethyl]-5-[(3,5-dimethylphenyl)methoxy]-1-azabicyclo[2.2.2]octane-3-carboxylic acid.
| Compound Name | (3S,4R,5S,6S)-6-[2-(3,5-dimethylphenyl)-1,1-diphenylethyl]-5-[(3,5-dimethylphenyl)methoxy]-1-azabicyclo[2.2.2]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 67656169 |
| Molecular Formula | C39H43NO3 |
| Molecular Weight | 573.78 g/mol |
| Exact Mass | 573.32 |
| IUPAC Name | (3S,4R,5S,6S)-6-[2-(3,5-dimethylphenyl)-1,1-diphenylethyl]-5-[(3,5-dimethylphenyl)methoxy]-1-azabicyclo[2.2.2]octane-3-carboxylic acid |
| SMILES | Cc1cc(C)cc(CO[C@H]2[C@@H]3CCN(C[C@H]3C(=O)O)[C@H]2C(Cc2cc(C)cc(C)c2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C39H43NO3/c1-26-17-27(2)20-30(19-26)23-39(32-11-7-5-8-12-32,33-13-9-6-10-14-33)37-36(34-15-16-40(37)24-35(34)38(41)42)43-25-31-21-28(3)18-29(4)22-31/h5-14,17-22,34-37H,15-16,23-25H2,1-4H3,(H,41,42)/t34-,35-,36+,37-/m1/s1 |
| InChIKey | MNTOXVXPAXRPNI-GOFGAPPUSA-N |
| XLogP | 7.44 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.78 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |