C25H18Cl2N4O4 — CID 67656417
N-[2,4-dichloro-3-[(2-methylimidazo[1,2-a]pyridin-8-yl)oxymethyl]phenyl]-2-(1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 67656417) has the molecular formula C25H18Cl2N4O4 and a molecular weight of 509.35 g/mol. Its IUPAC name is N-[2,4-dichloro-3-[(2-methylimidazo[1,2-a]pyridin-8-yl)oxymethyl]phenyl]-2-(1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-[2,4-dichloro-3-[(2-methylimidazo[1,2-a]pyridin-8-yl)oxymethyl]phenyl]-2-(1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 67656417 |
| Molecular Formula | C25H18Cl2N4O4 |
| Molecular Weight | 509.35 g/mol |
| Exact Mass | 508.07 |
| IUPAC Name | N-[2,4-dichloro-3-[(2-methylimidazo[1,2-a]pyridin-8-yl)oxymethyl]phenyl]-2-(1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | Cc1cn2cccc(OCc3c(Cl)ccc(NC(=O)CN4C(=O)c5ccccc5C4=O)c3Cl)c2n1 |
| InChI | InChI=1S/C25H18Cl2N4O4/c1-14-11-30-10-4-7-20(23(30)28-14)35-13-17-18(26)8-9-19(22(17)27)29-21(32)12-31-24(33)15-5-2-3-6-16(15)25(31)34/h2-11H,12-13H2,1H3,(H,29,32) |
| InChIKey | FPARVCUYDAAEGS-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.35 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|