C23H20N2O3S — CID 67656504
2-amino-3-[5,5-dimethyl-8-(1,3-thiazol-2-yl)-6H-naphthalene-2-carbonyl]benzoic acid (PubChem CID 67656504) has the molecular formula C23H20N2O3S and a molecular weight of 404.49 g/mol. Its IUPAC name is 2-amino-3-[5,5-dimethyl-8-(1,3-thiazol-2-yl)-6H-naphthalene-2-carbonyl]benzoic acid.
| Compound Name | 2-amino-3-[5,5-dimethyl-8-(1,3-thiazol-2-yl)-6H-naphthalene-2-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 67656504 |
| Molecular Formula | C23H20N2O3S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 2-amino-3-[5,5-dimethyl-8-(1,3-thiazol-2-yl)-6H-naphthalene-2-carbonyl]benzoic acid |
| SMILES | CC1(C)CC=C(c2nccs2)c2cc(C(=O)c3cccc(C(=O)O)c3N)ccc21 |
| InChI | InChI=1S/C23H20N2O3S/c1-23(2)9-8-14(21-25-10-11-29-21)17-12-13(6-7-18(17)23)20(26)15-4-3-5-16(19(15)24)22(27)28/h3-8,10-12H,9,24H2,1-2H3,(H,27,28) |
| InChIKey | LQKZVCWTORVZAO-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|