C31H32F3N3O2 — CID 67656680
3-benzamido-1-(1-pyrrolidin-1-ylbutyl)-N-(2,2,2-trifluoroethyl)-9H-fluorene-9-carboxamide (PubChem CID 67656680) has the molecular formula C31H32F3N3O2 and a molecular weight of 535.61 g/mol. Its IUPAC name is 3-benzamido-1-(1-pyrrolidin-1-ylbutyl)-N-(2,2,2-trifluoroethyl)-9H-fluorene-9-carboxamide.
| Compound Name | 3-benzamido-1-(1-pyrrolidin-1-ylbutyl)-N-(2,2,2-trifluoroethyl)-9H-fluorene-9-carboxamide |
|---|---|
| PubChem CID | 67656680 |
| Molecular Formula | C31H32F3N3O2 |
| Molecular Weight | 535.61 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | 3-benzamido-1-(1-pyrrolidin-1-ylbutyl)-N-(2,2,2-trifluoroethyl)-9H-fluorene-9-carboxamide |
| SMILES | CCCC(c1cc(NC(=O)c2ccccc2)cc2c1C(C(=O)NCC(F)(F)F)c1ccccc1-2)N1CCCC1 |
| InChI | InChI=1S/C31H32F3N3O2/c1-2-10-26(37-15-8-9-16-37)25-18-21(36-29(38)20-11-4-3-5-12-20)17-24-22-13-6-7-14-23(22)28(27(24)25)30(39)35-19-31(32,33)34/h3-7,11-14,17-18,26,28H,2,8-10,15-16,19H2,1H3,(H,35,39)(H,36,38) |
| InChIKey | CPVXLDXQRAYDIU-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.61 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |