About 4-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide
4-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 676567) has the molecular formula C9H7FN2O2S2
and a molecular weight of 258.30 g/mol. Its IUPAC name is 4-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| PubChem CID | 676567 |
| Molecular Formula | C9H7FN2O2S2 |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | 4-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1nccs1)c1ccc(F)cc1 |
| InChI | InChI=1S/C9H7FN2O2S2/c10-7-1-3-8(4-2-7)16(13,14)12-9-11-5-6-15-9/h1-6H,(H,11,12) |
| InChIKey | ZYDHXFFNDKCKKS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide?
The IUPAC name of 4-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide (CID 676567) is 4-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide.
What is the SMILES notation for 4-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide?
The canonical SMILES for 4-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide is O=S(=O)(Nc1nccs1)c1ccc(F)cc1.
What is the InChIKey of 4-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide?
The InChIKey is ZYDHXFFNDKCKKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7FN2O2S2/c10-7-1-3-8(4-2-7)16(13,14)12-9-11-5-6-15-9/h1-6H,(H,11,12).
What are the key properties of 4-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide?
4-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide has a molecular weight of 258.30 g/mol, XLogP of 2.08, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide is sourced from PubChem (CID 676567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).