About hydroxy-oxo-(1,3,5-triazin-2-yl)phosphanium
hydroxy-oxo-(1,3,5-triazin-2-yl)phosphanium (PubChem CID 67657189) has the molecular formula C3H3N3O2P+
and a molecular weight of 144.05 g/mol. Its IUPAC name is hydroxy-oxo-(1,3,5-triazin-2-yl)phosphanium.
Molecular Properties
| Compound Name | hydroxy-oxo-(1,3,5-triazin-2-yl)phosphanium |
| PubChem CID | 67657189 |
| Molecular Formula | C3H3N3O2P+ |
| Molecular Weight | 144.05 g/mol |
| Exact Mass | 144.00 |
| IUPAC Name | hydroxy-oxo-(1,3,5-triazin-2-yl)phosphanium |
| SMILES | O=[P+](O)c1ncncn1 |
| InChI | InChI=1S/C3H2N3O2P/c7-9(8)3-5-1-4-2-6-3/h1-2H/p+1 |
| InChIKey | MBJKWKAPMHOIFR-UHFFFAOYSA-O |
| XLogP | -0.77 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.05 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hydroxy-oxo-(1,3,5-triazin-2-yl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy-oxo-(1,3,5-triazin-2-yl)phosphanium?
The IUPAC name of hydroxy-oxo-(1,3,5-triazin-2-yl)phosphanium (CID 67657189) is hydroxy-oxo-(1,3,5-triazin-2-yl)phosphanium.
What is the SMILES notation for hydroxy-oxo-(1,3,5-triazin-2-yl)phosphanium?
The canonical SMILES for hydroxy-oxo-(1,3,5-triazin-2-yl)phosphanium is O=[P+](O)c1ncncn1.
What is the InChIKey of hydroxy-oxo-(1,3,5-triazin-2-yl)phosphanium?
The InChIKey is MBJKWKAPMHOIFR-UHFFFAOYSA-O. The full InChI is InChI=1S/C3H2N3O2P/c7-9(8)3-5-1-4-2-6-3/h1-2H/p+1.
What are the key properties of hydroxy-oxo-(1,3,5-triazin-2-yl)phosphanium?
hydroxy-oxo-(1,3,5-triazin-2-yl)phosphanium has a molecular weight of 144.05 g/mol, XLogP of -0.77, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy-oxo-(1,3,5-triazin-2-yl)phosphanium is sourced from PubChem (CID 67657189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).