About 2-(2,3-dioxo-4-piperidin-4-ylpiperazin-1-yl)-3-oxo-2-phenoxybutanoic acid;hydrochloride
2-(2,3-dioxo-4-piperidin-4-ylpiperazin-1-yl)-3-oxo-2-phenoxybutanoic acid;hydrochloride (PubChem CID 67657517) has the molecular formula C19H24ClN3O6
and a molecular weight of 425.87 g/mol. Its IUPAC name is 2-(2,3-dioxo-4-piperidin-4-ylpiperazin-1-yl)-3-oxo-2-phenoxybutanoic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-(2,3-dioxo-4-piperidin-4-ylpiperazin-1-yl)-3-oxo-2-phenoxybutanoic acid;hydrochloride |
| PubChem CID | 67657517 |
| Molecular Formula | C19H24ClN3O6 |
| Molecular Weight | 425.87 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 2-(2,3-dioxo-4-piperidin-4-ylpiperazin-1-yl)-3-oxo-2-phenoxybutanoic acid;hydrochloride |
| SMILES | CC(=O)C(Oc1ccccc1)(C(=O)O)N1CCN(C2CCNCC2)C(=O)C1=O.Cl |
| InChI | InChI=1S/C19H23N3O6.ClH/c1-13(23)19(18(26)27,28-15-5-3-2-4-6-15)22-12-11-21(16(24)17(22)25)14-7-9-20-10-8-14;/h2-6,14,20H,7-12H2,1H3,(H,26,27);1H |
| InChIKey | VOTITBWVSPJXKT-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.87 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,3-dioxo-4-piperidin-4-ylpiperazin-1-yl)-3-oxo-2-phenoxybutanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dioxo-4-piperidin-4-ylpiperazin-1-yl)-3-oxo-2-phenoxybutanoic acid;hydrochloride?
The IUPAC name of 2-(2,3-dioxo-4-piperidin-4-ylpiperazin-1-yl)-3-oxo-2-phenoxybutanoic acid;hydrochloride (CID 67657517) is 2-(2,3-dioxo-4-piperidin-4-ylpiperazin-1-yl)-3-oxo-2-phenoxybutanoic acid;hydrochloride.
What is the SMILES notation for 2-(2,3-dioxo-4-piperidin-4-ylpiperazin-1-yl)-3-oxo-2-phenoxybutanoic acid;hydrochloride?
The canonical SMILES for 2-(2,3-dioxo-4-piperidin-4-ylpiperazin-1-yl)-3-oxo-2-phenoxybutanoic acid;hydrochloride is CC(=O)C(Oc1ccccc1)(C(=O)O)N1CCN(C2CCNCC2)C(=O)C1=O.Cl.
What is the InChIKey of 2-(2,3-dioxo-4-piperidin-4-ylpiperazin-1-yl)-3-oxo-2-phenoxybutanoic acid;hydrochloride?
The InChIKey is VOTITBWVSPJXKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N3O6.ClH/c1-13(23)19(18(26)27,28-15-5-3-2-4-6-15)22-12-11-21(16(24)17(22)25)14-7-9-20-10-8-14;/h2-6,14,20H,7-12H2,1H3,(H,26,27);1H.
What are the key properties of 2-(2,3-dioxo-4-piperidin-4-ylpiperazin-1-yl)-3-oxo-2-phenoxybutanoic acid;hydrochloride?
2-(2,3-dioxo-4-piperidin-4-ylpiperazin-1-yl)-3-oxo-2-phenoxybutanoic acid;hydrochloride has a molecular weight of 425.87 g/mol, XLogP of 0.28, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dioxo-4-piperidin-4-ylpiperazin-1-yl)-3-oxo-2-phenoxybutanoic acid;hydrochloride is sourced from PubChem (CID 67657517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).