C9H8Cl2N4OS — CID 676576
6-amino-4-(2,4-dichlorophenyl)-5-sulfanyl-1,2-dihydro-1,2,4-triazin-3-one (PubChem CID 676576) has the molecular formula C9H8Cl2N4OS and a molecular weight of 291.16 g/mol. Its IUPAC name is 6-amino-4-(2,4-dichlorophenyl)-5-sulfanyl-1,2-dihydro-1,2,4-triazin-3-one.
| Compound Name | 6-amino-4-(2,4-dichlorophenyl)-5-sulfanyl-1,2-dihydro-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 676576 |
| Molecular Formula | C9H8Cl2N4OS |
| Molecular Weight | 291.16 g/mol |
| Exact Mass | 289.98 |
| IUPAC Name | 6-amino-4-(2,4-dichlorophenyl)-5-sulfanyl-1,2-dihydro-1,2,4-triazin-3-one |
| SMILES | NC1=C(S)N(c2ccc(Cl)cc2Cl)C(=O)NN1 |
| InChI | InChI=1S/C9H8Cl2N4OS/c10-4-1-2-6(5(11)3-4)15-8(17)7(12)13-14-9(15)16/h1-3,13,17H,12H2,(H,14,16) |
| InChIKey | FZEPGGKXKAXUTJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.16 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|