C32H62O3Si2 — CID 67657694
(E)-7-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[8-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopent-3-en-1-yl]hept-5-en-1-ol (PubChem CID 67657694) has the molecular formula C32H62O3Si2 and a molecular weight of 551.02 g/mol. Its IUPAC name is (E)-7-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[8-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopent-3-en-1-yl]hept-5-en-1-ol.
| Compound Name | (E)-7-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[8-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopent-3-en-1-yl]hept-5-en-1-ol |
|---|---|
| PubChem CID | 67657694 |
| Molecular Formula | C32H62O3Si2 |
| Molecular Weight | 551.02 g/mol |
| Exact Mass | 550.42 |
| IUPAC Name | (E)-7-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[8-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopent-3-en-1-yl]hept-5-en-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCCCC=C[C@@]1(O[Si](C)(C)C(C)(C)C)C=CC[C@H]1C/C=C/CCCCO |
| InChI | InChI=1S/C32H62O3Si2/c1-30(2,3)36(7,8)34-28-21-17-12-11-15-19-25-32(35-37(9,10)31(4,5)6)26-22-24-29(32)23-18-14-13-16-20-27-33/h14,18-19,22,25-26,29,33H,11-13,15-17,20-21,23-24,27-28H2,1-10H3/b18-14+,25-19?/t29-,32-/m1/s1 |
| InChIKey | VTQFCBLSWOYMCS-REDBJDGCSA-N |
| XLogP | 9.96 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.02 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|