C17H20N4O3 — CID 67658340
(6-butyl-1'-nitrospiro[3,5,7-triazatricyclo[5.2.1.04,8]deca-1(9),2,4(8)-triene-10,6'-cyclohexa-1,3-diene]-2-yl)methanol (PubChem CID 67658340) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is (6-butyl-1'-nitrospiro[3,5,7-triazatricyclo[5.2.1.04,8]deca-1(9),2,4(8)-triene-10,6'-cyclohexa-1,3-diene]-2-yl)methanol.
| Compound Name | (6-butyl-1'-nitrospiro[3,5,7-triazatricyclo[5.2.1.04,8]deca-1(9),2,4(8)-triene-10,6'-cyclohexa-1,3-diene]-2-yl)methanol |
|---|---|
| PubChem CID | 67658340 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | (6-butyl-1'-nitrospiro[3,5,7-triazatricyclo[5.2.1.04,8]deca-1(9),2,4(8)-triene-10,6'-cyclohexa-1,3-diene]-2-yl)methanol |
| SMILES | CCCCC1Nc2nc(CO)c3cc2N1C31CC=CC=C1[N+](=O)[O-] |
| InChI | InChI=1S/C17H20N4O3/c1-2-3-7-15-19-16-13-9-11(12(10-22)18-16)17(20(13)15)8-5-4-6-14(17)21(23)24/h4-6,9,15,22H,2-3,7-8,10H2,1H3,(H,18,19) |
| InChIKey | DKQACRVRSZEABQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 91.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|