methyl 2-[4-(3-butylquinolin-4-yl)-2-methylphenyl]benzoate

C28H27NO2 — CID 67658453

IUPACmethyl 2-[4-(3-butylquinolin-4-yl)-2-methylphenyl]benzoate
SMILESCCCCc1cnc2ccccc2c1-c1ccc(-c2ccccc2C(=O)OC)c(C)c1
InChIInChI=1S/C28H27NO2/c1-4-5-10-21-18-29-26-14-9-8-13-25(26)27(21)20-15-16-22(19(2)17-20)23-11-6-7-12-24(23)28(30)31-3/h6-9,11-18H,4-5,10H2,1-3H3
InChIKeyUDHFFWMYCWSXIM-UHFFFAOYSA-N
MW409.53 g/mol
LogP7.01
Rot. Bonds6

About methyl 2-[4-(3-butylquinolin-4-yl)-2-methylphenyl]benzoate

methyl 2-[4-(3-butylquinolin-4-yl)-2-methylphenyl]benzoate (PubChem CID 67658453) has the molecular formula C28H27NO2 and a molecular weight of 409.53 g/mol. Its IUPAC name is methyl 2-[4-(3-butylquinolin-4-yl)-2-methylphenyl]benzoate.

Molecular Properties

Compound Namemethyl 2-[4-(3-butylquinolin-4-yl)-2-methylphenyl]benzoate
PubChem CID67658453
Molecular FormulaC28H27NO2
Molecular Weight409.53 g/mol
Exact Mass409.20
IUPAC Namemethyl 2-[4-(3-butylquinolin-4-yl)-2-methylphenyl]benzoate
SMILESCCCCc1cnc2ccccc2c1-c1ccc(-c2ccccc2C(=O)OC)c(C)c1
InChIInChI=1S/C28H27NO2/c1-4-5-10-21-18-29-26-14-9-8-13-25(26)27(21)20-15-16-22(19(2)17-20)23-11-6-7-12-24(23)28(30)31-3/h6-9,11-18H,4-5,10H2,1-3H3
InChIKeyUDHFFWMYCWSXIM-UHFFFAOYSA-N
XLogP7.01
TPSA39.19 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms31
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500409.53
LogP ≤ 57.01
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 2-[4-(3-butylquinolin-4-yl)-2-methylphenyl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[4-(3-butylquinolin-4-yl)-2-methylphenyl]benzoate?
The IUPAC name of methyl 2-[4-(3-butylquinolin-4-yl)-2-methylphenyl]benzoate (CID 67658453) is methyl 2-[4-(3-butylquinolin-4-yl)-2-methylphenyl]benzoate.
What is the SMILES notation for methyl 2-[4-(3-butylquinolin-4-yl)-2-methylphenyl]benzoate?
The canonical SMILES for methyl 2-[4-(3-butylquinolin-4-yl)-2-methylphenyl]benzoate is CCCCc1cnc2ccccc2c1-c1ccc(-c2ccccc2C(=O)OC)c(C)c1.
What is the InChIKey of methyl 2-[4-(3-butylquinolin-4-yl)-2-methylphenyl]benzoate?
The InChIKey is UDHFFWMYCWSXIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H27NO2/c1-4-5-10-21-18-29-26-14-9-8-13-25(26)27(21)20-15-16-22(19(2)17-20)23-11-6-7-12-24(23)28(30)31-3/h6-9,11-18H,4-5,10H2,1-3H3.
What are the key properties of methyl 2-[4-(3-butylquinolin-4-yl)-2-methylphenyl]benzoate?
methyl 2-[4-(3-butylquinolin-4-yl)-2-methylphenyl]benzoate has a molecular weight of 409.53 g/mol, XLogP of 7.01, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[4-(3-butylquinolin-4-yl)-2-methylphenyl]benzoate is sourced from PubChem (CID 67658453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).