C25H29F2NO3 — CID 67658666
N-[2,4-difluoro-6-(2-phenylethynyl)phenyl]-2,2-dimethylpropanamide;ethyl 2-methylpropanoate (PubChem CID 67658666) has the molecular formula C25H29F2NO3 and a molecular weight of 429.51 g/mol. Its IUPAC name is N-[2,4-difluoro-6-(2-phenylethynyl)phenyl]-2,2-dimethylpropanamide;ethyl 2-methylpropanoate.
| Compound Name | N-[2,4-difluoro-6-(2-phenylethynyl)phenyl]-2,2-dimethylpropanamide;ethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 67658666 |
| Molecular Formula | C25H29F2NO3 |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | N-[2,4-difluoro-6-(2-phenylethynyl)phenyl]-2,2-dimethylpropanamide;ethyl 2-methylpropanoate |
| SMILES | CC(C)(C)C(=O)Nc1c(F)cc(F)cc1C#Cc1ccccc1.CCOC(=O)C(C)C |
| InChI | InChI=1S/C19H17F2NO.C6H12O2/c1-19(2,3)18(23)22-17-14(11-15(20)12-16(17)21)10-9-13-7-5-4-6-8-13;1-4-8-6(7)5(2)3/h4-8,11-12H,1-3H3,(H,22,23);5H,4H2,1-3H3 |
| InChIKey | YZBFJRJMIDWQKE-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|