C25H27NO4 — CID 67658914
tert-butyl 2-oxo-1-[2-(2-phenylmethoxyphenyl)ethyl]pyridine-3-carboxylate (PubChem CID 67658914) has the molecular formula C25H27NO4 and a molecular weight of 405.49 g/mol. Its IUPAC name is tert-butyl 2-oxo-1-[2-(2-phenylmethoxyphenyl)ethyl]pyridine-3-carboxylate.
| Compound Name | tert-butyl 2-oxo-1-[2-(2-phenylmethoxyphenyl)ethyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 67658914 |
| Molecular Formula | C25H27NO4 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | tert-butyl 2-oxo-1-[2-(2-phenylmethoxyphenyl)ethyl]pyridine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1cccn(CCc2ccccc2OCc2ccccc2)c1=O |
| InChI | InChI=1S/C25H27NO4/c1-25(2,3)30-24(28)21-13-9-16-26(23(21)27)17-15-20-12-7-8-14-22(20)29-18-19-10-5-4-6-11-19/h4-14,16H,15,17-18H2,1-3H3 |
| InChIKey | XLKPUNBRNUVSQF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |